C19H12N4O6S — CID 58174439
N-benzo[h]quinolin-10-yl-2,4-dinitrobenzenesulfonamide (PubChem CID 58174439) has the molecular formula C19H12N4O6S and a molecular weight of 424.39 g/mol. Its IUPAC name is N-benzo[h]quinolin-10-yl-2,4-dinitrobenzenesulfonamide.
| Compound Name | N-benzo[h]quinolin-10-yl-2,4-dinitrobenzenesulfonamide |
|---|---|
| PubChem CID | 58174439 |
| Molecular Formula | C19H12N4O6S |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | N-benzo[h]quinolin-10-yl-2,4-dinitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)Nc2cccc3ccc4cccnc4c23)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H12N4O6S/c24-22(25)14-8-9-17(16(11-14)23(26)27)30(28,29)21-15-5-1-3-12-6-7-13-4-2-10-20-19(13)18(12)15/h1-11,21H |
| InChIKey | VRKJLWGNVRLHFM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 145.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|