C33H29IrN2O- — CID 58175616
2-(3H-dibenzofuran-3-id-2-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazole;iridium (PubChem CID 58175616) has the molecular formula C33H29IrN2O- and a molecular weight of 661.83 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-2-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazole;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-2-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazole;iridium |
|---|---|
| PubChem CID | 58175616 |
| Molecular Formula | C33H29IrN2O- |
| Molecular Weight | 661.83 g/mol |
| Exact Mass | 662.19 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-2-yl)-1-[4-phenyl-2,6-di(propan-2-yl)phenyl]imidazole;iridium |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1ccnc1-c1[c-]cc2oc3ccccc3c2c1.[Ir] |
| InChI | InChI=1S/C33H29N2O.Ir/c1-21(2)27-19-25(23-10-6-5-7-11-23)20-28(22(3)4)32(27)35-17-16-34-33(35)24-14-15-31-29(18-24)26-12-8-9-13-30(26)36-31;/h5-13,15-22H,1-4H3;/q-1; |
| InChIKey | QSFLEBGZIYCYBW-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.83 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|