C25H21ClN4O2 — CID 58175846
3-[[4-(2-chloroanilino)-6-[(3-methoxyphenyl)methyl]-1,3,5-triazin-2-yl]methyl]benzaldehyde (PubChem CID 58175846) has the molecular formula C25H21ClN4O2 and a molecular weight of 444.92 g/mol. Its IUPAC name is 3-[[4-(2-chloroanilino)-6-[(3-methoxyphenyl)methyl]-1,3,5-triazin-2-yl]methyl]benzaldehyde.
| Compound Name | 3-[[4-(2-chloroanilino)-6-[(3-methoxyphenyl)methyl]-1,3,5-triazin-2-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 58175846 |
| Molecular Formula | C25H21ClN4O2 |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 3-[[4-(2-chloroanilino)-6-[(3-methoxyphenyl)methyl]-1,3,5-triazin-2-yl]methyl]benzaldehyde |
| SMILES | COc1cccc(Cc2nc(Cc3cccc(C=O)c3)nc(Nc3ccccc3Cl)n2)c1 |
| InChI | InChI=1S/C25H21ClN4O2/c1-32-20-9-5-7-18(13-20)15-24-28-23(14-17-6-4-8-19(12-17)16-31)29-25(30-24)27-22-11-3-2-10-21(22)26/h2-13,16H,14-15H2,1H3,(H,27,28,29,30) |
| InChIKey | GUZATTHLAUGKQB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|