C26H24N4O2 — CID 58175834
3-[[4-[(3-methoxyphenyl)methyl]-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]benzaldehyde (PubChem CID 58175834) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[[4-[(3-methoxyphenyl)methyl]-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]benzaldehyde.
| Compound Name | 3-[[4-[(3-methoxyphenyl)methyl]-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 58175834 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 3-[[4-[(3-methoxyphenyl)methyl]-6-(3-methylanilino)-1,3,5-triazin-2-yl]methyl]benzaldehyde |
| SMILES | COc1cccc(Cc2nc(Cc3cccc(C=O)c3)nc(Nc3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C26H24N4O2/c1-18-6-3-10-22(12-18)27-26-29-24(15-19-7-4-9-21(13-19)17-31)28-25(30-26)16-20-8-5-11-23(14-20)32-2/h3-14,17H,15-16H2,1-2H3,(H,27,28,29,30) |
| InChIKey | VPVGVEOKSKHCDP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|