C28H28N4O2 — CID 20769851
(4-phenylphenyl) 4-[(4,6-dipropyl-1,3,5-triazin-2-yl)amino]benzoate (PubChem CID 20769851) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is (4-phenylphenyl) 4-[(4,6-dipropyl-1,3,5-triazin-2-yl)amino]benzoate.
| Compound Name | (4-phenylphenyl) 4-[(4,6-dipropyl-1,3,5-triazin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 20769851 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (4-phenylphenyl) 4-[(4,6-dipropyl-1,3,5-triazin-2-yl)amino]benzoate |
| SMILES | CCCc1nc(CCC)nc(Nc2ccc(C(=O)Oc3ccc(-c4ccccc4)cc3)cc2)n1 |
| InChI | InChI=1S/C28H28N4O2/c1-3-8-25-30-26(9-4-2)32-28(31-25)29-23-16-12-22(13-17-23)27(33)34-24-18-14-21(15-19-24)20-10-6-5-7-11-20/h5-7,10-19H,3-4,8-9H2,1-2H3,(H,29,30,31,32) |
| InChIKey | FONSMZMODZSRIV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|