C20H21N2O2Si — CID 58175947
CID 58175947 (PubChem CID 58175947) has the molecular formula C20H21N2O2Si and a molecular weight of 349.49 g/mol.
| Compound Name | CID 58175947 |
|---|---|
| PubChem CID | 58175947 |
| Molecular Formula | C20H21N2O2Si |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | — |
| SMILES | CCO[Si](OCC)c1ccc(-c2ccc(-c3ccccn3)nc2)cc1 |
| InChI | InChI=1S/C20H21N2O2Si/c1-3-23-25(24-4-2)18-11-8-16(9-12-18)17-10-13-20(22-15-17)19-7-5-6-14-21-19/h5-15H,3-4H2,1-2H3 |
| InChIKey | VBPSBWIAAUVICM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|