C14H18N2O8P2 — CID 58175956
2-[[2-[4-(2-phosphonoethoxy)-2-pyridinyl]-4-pyridinyl]oxy]ethylphosphonic acid (PubChem CID 58175956) has the molecular formula C14H18N2O8P2 and a molecular weight of 404.25 g/mol. Its IUPAC name is 2-[[2-[4-(2-phosphonoethoxy)-2-pyridinyl]-4-pyridinyl]oxy]ethylphosphonic acid.
| Compound Name | 2-[[2-[4-(2-phosphonoethoxy)-2-pyridinyl]-4-pyridinyl]oxy]ethylphosphonic acid |
|---|---|
| PubChem CID | 58175956 |
| Molecular Formula | C14H18N2O8P2 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | 2-[[2-[4-(2-phosphonoethoxy)-2-pyridinyl]-4-pyridinyl]oxy]ethylphosphonic acid |
| SMILES | O=P(O)(O)CCOc1ccnc(-c2cc(OCCP(=O)(O)O)ccn2)c1 |
| InChI | InChI=1S/C14H18N2O8P2/c17-25(18,19)7-5-23-11-1-3-15-13(9-11)14-10-12(2-4-16-14)24-6-8-26(20,21)22/h1-4,9-10H,5-8H2,(H2,17,18,19)(H2,20,21,22) |
| InChIKey | ANXICKFCKPIVMF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 159.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|