C18H26O8P2 — CID 19613993
4-[6-(4-phosphonobutoxy)naphthalen-2-yl]oxybutylphosphonic acid (PubChem CID 19613993) has the molecular formula C18H26O8P2 and a molecular weight of 432.35 g/mol. Its IUPAC name is 4-[6-(4-phosphonobutoxy)naphthalen-2-yl]oxybutylphosphonic acid.
| Compound Name | 4-[6-(4-phosphonobutoxy)naphthalen-2-yl]oxybutylphosphonic acid |
|---|---|
| PubChem CID | 19613993 |
| Molecular Formula | C18H26O8P2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 4-[6-(4-phosphonobutoxy)naphthalen-2-yl]oxybutylphosphonic acid |
| SMILES | O=P(O)(O)CCCCOc1ccc2cc(OCCCCP(=O)(O)O)ccc2c1 |
| InChI | InChI=1S/C18H26O8P2/c19-27(20,21)11-3-1-9-25-17-7-5-16-14-18(8-6-15(16)13-17)26-10-2-4-12-28(22,23)24/h5-8,13-14H,1-4,9-12H2,(H2,19,20,21)(H2,22,23,24) |
| InChIKey | FXIKKGIKMSQZOL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|