C24H30N3O3Si+ — CID 58177708
trimethoxy-[3-[4-[(E)-2-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]ethenyl]pyridin-1-ium-1-yl]propyl]silane (PubChem CID 58177708) has the molecular formula C24H30N3O3Si+ and a molecular weight of 436.61 g/mol. Its IUPAC name is trimethoxy-[3-[4-[(E)-2-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]ethenyl]pyridin-1-ium-1-yl]propyl]silane.
| Compound Name | trimethoxy-[3-[4-[(E)-2-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]ethenyl]pyridin-1-ium-1-yl]propyl]silane |
|---|---|
| PubChem CID | 58177708 |
| Molecular Formula | C24H30N3O3Si+ |
| Molecular Weight | 436.61 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | trimethoxy-[3-[4-[(E)-2-[2-(4-methyl-2-pyridinyl)-4-pyridinyl]ethenyl]pyridin-1-ium-1-yl]propyl]silane |
| SMILES | CO[Si](CCC[n+]1ccc(/C=C/c2ccnc(-c3cc(C)ccn3)c2)cc1)(OC)OC |
| InChI | InChI=1S/C24H30N3O3Si/c1-20-8-12-25-23(18-20)24-19-22(9-13-26-24)7-6-21-10-15-27(16-11-21)14-5-17-31(28-2,29-3)30-4/h6-13,15-16,18-19H,5,14,17H2,1-4H3/q+1/b7-6+ |
| InChIKey | IHELWVWTRXSJQC-VOTSOKGWSA-N |
| XLogP | 4.18 |
| TPSA | 57.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.61 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|