C19H21F5NO3Si+ — CID 102197585
trimethoxy-[3-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]pyridin-1-ium-1-yl]propyl]silane (PubChem CID 102197585) has the molecular formula C19H21F5NO3Si+ and a molecular weight of 434.46 g/mol. Its IUPAC name is trimethoxy-[3-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]pyridin-1-ium-1-yl]propyl]silane.
| Compound Name | trimethoxy-[3-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]pyridin-1-ium-1-yl]propyl]silane |
|---|---|
| PubChem CID | 102197585 |
| Molecular Formula | C19H21F5NO3Si+ |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | trimethoxy-[3-[4-[(E)-2-(2,3,4,5,6-pentafluorophenyl)ethenyl]pyridin-1-ium-1-yl]propyl]silane |
| SMILES | CO[Si](CCC[n+]1ccc(/C=C/c2c(F)c(F)c(F)c(F)c2F)cc1)(OC)OC |
| InChI | InChI=1S/C19H21F5NO3Si/c1-26-29(27-2,28-3)12-4-9-25-10-7-13(8-11-25)5-6-14-15(20)17(22)19(24)18(23)16(14)21/h5-8,10-11H,4,9,12H2,1-3H3/q+1/b6-5+ |
| InChIKey | XJRVHTODDQBEAT-AATRIKPKSA-N |
| XLogP | 4.11 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|