C11H12N2O3 — CID 58182046
N-[3-(furan-2-yl)-1,2-oxazol-5-yl]-2-methylpropanamide (PubChem CID 58182046) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-[3-(furan-2-yl)-1,2-oxazol-5-yl]-2-methylpropanamide.
| Compound Name | N-[3-(furan-2-yl)-1,2-oxazol-5-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 58182046 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | N-[3-(furan-2-yl)-1,2-oxazol-5-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cc(-c2ccco2)no1 |
| InChI | InChI=1S/C11H12N2O3/c1-7(2)11(14)12-10-6-8(13-16-10)9-4-3-5-15-9/h3-7H,1-2H3,(H,12,14) |
| InChIKey | VMEWDZQYVJAVLP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |