C12H8N2O3S — CID 53143213
N-[3-(furan-2-yl)-1,2-oxazol-5-yl]thiophene-2-carboxamide (PubChem CID 53143213) has the molecular formula C12H8N2O3S and a molecular weight of 260.27 g/mol. Its IUPAC name is N-[3-(furan-2-yl)-1,2-oxazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[3-(furan-2-yl)-1,2-oxazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 53143213 |
| Molecular Formula | C12H8N2O3S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | N-[3-(furan-2-yl)-1,2-oxazol-5-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(-c2ccco2)no1)c1cccs1 |
| InChI | InChI=1S/C12H8N2O3S/c15-12(10-4-2-6-18-10)13-11-7-8(14-17-11)9-3-1-5-16-9/h1-7H,(H,13,15) |
| InChIKey | VIXKGCIMRKMDMM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |