C35H44O3 — CID 58183937
1-[3-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]phenyl]propane-1,2-dione (PubChem CID 58183937) has the molecular formula C35H44O3 and a molecular weight of 512.73 g/mol. Its IUPAC name is 1-[3-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]phenyl]propane-1,2-dione.
| Compound Name | 1-[3-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]phenyl]propane-1,2-dione |
|---|---|
| PubChem CID | 58183937 |
| Molecular Formula | C35H44O3 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 512.33 |
| IUPAC Name | 1-[3-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]phenyl]propane-1,2-dione |
| SMILES | CCC(CC)(c1ccc(CCC(O)C(C)(C)C)c(C)c1)c1ccc(-c2cccc(C(=O)C(C)=O)c2)c(C)c1 |
| InChI | InChI=1S/C35H44O3/c1-9-35(10-2,29-16-14-26(23(3)20-29)15-19-32(37)34(6,7)8)30-17-18-31(24(4)21-30)27-12-11-13-28(22-27)33(38)25(5)36/h11-14,16-18,20-22,32,37H,9-10,15,19H2,1-8H3 |
| InChIKey | SELDIVFDZJVHAK-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|