C35H46O2 — CID 89188442
3-[3-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]phenyl]propanal (PubChem CID 89188442) has the molecular formula C35H46O2 and a molecular weight of 498.75 g/mol. Its IUPAC name is 3-[3-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]phenyl]propanal.
| Compound Name | 3-[3-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]phenyl]propanal |
|---|---|
| PubChem CID | 89188442 |
| Molecular Formula | C35H46O2 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.35 |
| IUPAC Name | 3-[3-[4-[3-[4-(3-hydroxy-4,4-dimethylpentyl)-3-methylphenyl]pentan-3-yl]-2-methylphenyl]phenyl]propanal |
| SMILES | CCC(CC)(c1ccc(CCC(O)C(C)(C)C)c(C)c1)c1ccc(-c2cccc(CCC=O)c2)c(C)c1 |
| InChI | InChI=1S/C35H46O2/c1-8-35(9-2,30-17-15-28(25(3)22-30)16-20-33(37)34(5,6)7)31-18-19-32(26(4)23-31)29-14-10-12-27(24-29)13-11-21-36/h10,12,14-15,17-19,21-24,33,37H,8-9,11,13,16,20H2,1-7H3 |
| InChIKey | ANHFWGYYLVCALR-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|