C29H42O — CID 58598572
4,4-dimethyl-1-[2-methyl-4-[3-(3-methyl-4-prop-2-enylphenyl)pentan-3-yl]phenyl]pentan-3-ol (PubChem CID 58598572) has the molecular formula C29H42O and a molecular weight of 406.65 g/mol. Its IUPAC name is 4,4-dimethyl-1-[2-methyl-4-[3-(3-methyl-4-prop-2-enylphenyl)pentan-3-yl]phenyl]pentan-3-ol.
| Compound Name | 4,4-dimethyl-1-[2-methyl-4-[3-(3-methyl-4-prop-2-enylphenyl)pentan-3-yl]phenyl]pentan-3-ol |
|---|---|
| PubChem CID | 58598572 |
| Molecular Formula | C29H42O |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | 4,4-dimethyl-1-[2-methyl-4-[3-(3-methyl-4-prop-2-enylphenyl)pentan-3-yl]phenyl]pentan-3-ol |
| SMILES | C=CCc1ccc(C(CC)(CC)c2ccc(CCC(O)C(C)(C)C)c(C)c2)cc1C |
| InChI | InChI=1S/C29H42O/c1-9-12-23-13-16-25(19-21(23)4)29(10-2,11-3)26-17-14-24(22(5)20-26)15-18-27(30)28(6,7)8/h9,13-14,16-17,19-20,27,30H,1,10-12,15,18H2,2-8H3 |
| InChIKey | QQNSJENBCYHQCL-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|