C19H19NO5 — CID 58187271
4-butyl-6-phenylmethoxy-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58187271) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 4-butyl-6-phenylmethoxy-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-butyl-6-phenylmethoxy-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58187271 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-butyl-6-phenylmethoxy-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | CCCCc1cc(=O)oc2c1C(=O)N(OCc1ccccc1)C(=O)C2 |
| InChI | InChI=1S/C19H19NO5/c1-2-3-9-14-10-17(22)25-15-11-16(21)20(19(23)18(14)15)24-12-13-7-5-4-6-8-13/h4-8,10H,2-3,9,11-12H2,1H3 |
| InChIKey | KUXQDWSXCVPWIQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|