C19H19NO4 — CID 58317253
4-butyl-3-(4-methylphenyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione (PubChem CID 58317253) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 4-butyl-3-(4-methylphenyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione.
| Compound Name | 4-butyl-3-(4-methylphenyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
|---|---|
| PubChem CID | 58317253 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 4-butyl-3-(4-methylphenyl)-8H-pyrano[3,2-c]pyridine-2,5,7-trione |
| SMILES | CCCCc1c2c(oc(=O)c1-c1ccc(C)cc1)CC(=O)NC2=O |
| InChI | InChI=1S/C19H19NO4/c1-3-4-5-13-16(12-8-6-11(2)7-9-12)19(23)24-14-10-15(21)20-18(22)17(13)14/h6-9H,3-5,10H2,1-2H3,(H,20,21,22) |
| InChIKey | AYKVOYNMLLLCDV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|