C13H7Cl2NO4S2 — CID 58189520
methyl 4-chloro-2-chlorosulfonylthieno[2,3-c]quinoline-6-carboxylate (PubChem CID 58189520) has the molecular formula C13H7Cl2NO4S2 and a molecular weight of 376.24 g/mol. Its IUPAC name is methyl 4-chloro-2-chlorosulfonylthieno[2,3-c]quinoline-6-carboxylate.
| Compound Name | methyl 4-chloro-2-chlorosulfonylthieno[2,3-c]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 58189520 |
| Molecular Formula | C13H7Cl2NO4S2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 374.92 |
| IUPAC Name | methyl 4-chloro-2-chlorosulfonylthieno[2,3-c]quinoline-6-carboxylate |
| SMILES | COC(=O)c1cccc2c1nc(Cl)c1sc(S(=O)(=O)Cl)cc12 |
| InChI | InChI=1S/C13H7Cl2NO4S2/c1-20-13(17)7-4-2-3-6-8-5-9(22(15,18)19)21-11(8)12(14)16-10(6)7/h2-5H,1H3 |
| InChIKey | WKXBHGIXKLXAKA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|