C13H8ClNO2S — CID 58189539
methyl 4-chlorothieno[3,4-c]quinoline-6-carboxylate (PubChem CID 58189539) has the molecular formula C13H8ClNO2S and a molecular weight of 277.73 g/mol. Its IUPAC name is methyl 4-chlorothieno[3,4-c]quinoline-6-carboxylate.
| Compound Name | methyl 4-chlorothieno[3,4-c]quinoline-6-carboxylate |
|---|---|
| PubChem CID | 58189539 |
| Molecular Formula | C13H8ClNO2S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | methyl 4-chlorothieno[3,4-c]quinoline-6-carboxylate |
| SMILES | COC(=O)c1cccc2c1nc(Cl)c1cscc12 |
| InChI | InChI=1S/C13H8ClNO2S/c1-17-13(16)8-4-2-3-7-9-5-18-6-10(9)12(14)15-11(7)8/h2-6H,1H3 |
| InChIKey | DAGDFWDKTCKDPF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|