C15H11N3O4 — CID 146442513
methyl 6-carbamoyl-11-oxopyrido[2,1-b]quinazoline-4-carboxylate (PubChem CID 146442513) has the molecular formula C15H11N3O4 and a molecular weight of 297.27 g/mol. Its IUPAC name is methyl 6-carbamoyl-11-oxopyrido[2,1-b]quinazoline-4-carboxylate.
| Compound Name | methyl 6-carbamoyl-11-oxopyrido[2,1-b]quinazoline-4-carboxylate |
|---|---|
| PubChem CID | 146442513 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | methyl 6-carbamoyl-11-oxopyrido[2,1-b]quinazoline-4-carboxylate |
| SMILES | COC(=O)c1cccc2c(=O)n3cccc(C(N)=O)c3nc12 |
| InChI | InChI=1S/C15H11N3O4/c1-22-15(21)9-5-2-4-8-11(9)17-13-10(12(16)19)6-3-7-18(13)14(8)20/h2-7H,1H3,(H2,16,19) |
| InChIKey | BQWFLGAXHGYWRP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|