C20H19N5O2 — CID 58190524
2-[(E)-1-[3-(quinolin-6-ylmethyl)imidazo[1,2-a]pyrimidin-6-yl]ethylideneamino]oxyethanol (PubChem CID 58190524) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 2-[(E)-1-[3-(quinolin-6-ylmethyl)imidazo[1,2-a]pyrimidin-6-yl]ethylideneamino]oxyethanol.
| Compound Name | 2-[(E)-1-[3-(quinolin-6-ylmethyl)imidazo[1,2-a]pyrimidin-6-yl]ethylideneamino]oxyethanol |
|---|---|
| PubChem CID | 58190524 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-[(E)-1-[3-(quinolin-6-ylmethyl)imidazo[1,2-a]pyrimidin-6-yl]ethylideneamino]oxyethanol |
| SMILES | C/C(=N\OCCO)c1cnc2ncc(Cc3ccc4ncccc4c3)n2c1 |
| InChI | InChI=1S/C20H19N5O2/c1-14(24-27-8-7-26)17-11-22-20-23-12-18(25(20)13-17)10-15-4-5-19-16(9-15)3-2-6-21-19/h2-6,9,11-13,26H,7-8,10H2,1H3/b24-14+ |
| InChIKey | ZBIAOZAZIWNFSE-ZVHZXABRSA-N |
| XLogP | 2.60 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|