C21H20FN5O2 — CID 75596564
2-[1-[3-[1-(7-fluoroquinolin-6-yl)ethyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]oxyethanol (PubChem CID 75596564) has the molecular formula C21H20FN5O2 and a molecular weight of 393.42 g/mol. Its IUPAC name is 2-[1-[3-[1-(7-fluoroquinolin-6-yl)ethyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]oxyethanol.
| Compound Name | 2-[1-[3-[1-(7-fluoroquinolin-6-yl)ethyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]oxyethanol |
|---|---|
| PubChem CID | 75596564 |
| Molecular Formula | C21H20FN5O2 |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-[1-[3-[1-(7-fluoroquinolin-6-yl)ethyl]imidazo[1,2-b]pyridazin-6-yl]ethylideneamino]oxyethanol |
| SMILES | CC(=NOCCO)c1ccc2ncc(C(C)c3cc4cccnc4cc3F)n2n1 |
| InChI | InChI=1S/C21H20FN5O2/c1-13(16-10-15-4-3-7-23-19(15)11-17(16)22)20-12-24-21-6-5-18(25-27(20)21)14(2)26-29-9-8-28/h3-7,10-13,28H,8-9H2,1-2H3 |
| InChIKey | GDAYFDQSHBRCBT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|