C19H17FN6O2S — CID 123454196
N'-[1-[3-[(7-fluoroquinolin-6-yl)methyl]imidazo[1,2-b]pyridazin-6-yl]ethenyl]methanesulfonohydrazide (PubChem CID 123454196) has the molecular formula C19H17FN6O2S and a molecular weight of 412.45 g/mol. Its IUPAC name is N'-[1-[3-[(7-fluoroquinolin-6-yl)methyl]imidazo[1,2-b]pyridazin-6-yl]ethenyl]methanesulfonohydrazide.
| Compound Name | N'-[1-[3-[(7-fluoroquinolin-6-yl)methyl]imidazo[1,2-b]pyridazin-6-yl]ethenyl]methanesulfonohydrazide |
|---|---|
| PubChem CID | 123454196 |
| Molecular Formula | C19H17FN6O2S |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N'-[1-[3-[(7-fluoroquinolin-6-yl)methyl]imidazo[1,2-b]pyridazin-6-yl]ethenyl]methanesulfonohydrazide |
| SMILES | C=C(NNS(C)(=O)=O)c1ccc2ncc(Cc3cc4cccnc4cc3F)n2n1 |
| InChI | InChI=1S/C19H17FN6O2S/c1-12(23-25-29(2,27)28)17-5-6-19-22-11-15(26(19)24-17)9-14-8-13-4-3-7-21-18(13)10-16(14)20/h3-8,10-11,23,25H,1,9H2,2H3 |
| InChIKey | JXQXONXONWJUHS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|