C26H28N2O5S2 — CID 58195049
N-[[6-[3-tert-butyl-5-(2,4-dioxo-1-pyridinyl)-2-methoxyphenyl]-1-benzothiophen-2-yl]methyl]methanesulfonamide (PubChem CID 58195049) has the molecular formula C26H28N2O5S2 and a molecular weight of 512.65 g/mol. Its IUPAC name is N-[[6-[3-tert-butyl-5-(2,4-dioxo-1-pyridinyl)-2-methoxyphenyl]-1-benzothiophen-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[6-[3-tert-butyl-5-(2,4-dioxo-1-pyridinyl)-2-methoxyphenyl]-1-benzothiophen-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 58195049 |
| Molecular Formula | C26H28N2O5S2 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | N-[[6-[3-tert-butyl-5-(2,4-dioxo-1-pyridinyl)-2-methoxyphenyl]-1-benzothiophen-2-yl]methyl]methanesulfonamide |
| SMILES | COc1c(-c2ccc3cc(CNS(C)(=O)=O)sc3c2)cc(N2C=CC(=O)CC2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C26H28N2O5S2/c1-26(2,3)22-13-18(28-9-8-19(29)14-24(28)30)12-21(25(22)33-4)16-6-7-17-10-20(34-23(17)11-16)15-27-35(5,31)32/h6-13,27H,14-15H2,1-5H3 |
| InChIKey | FVBWINOJUMVKBE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|