C25H32N4O5S — CID 58536716
N-[[(3S)-1-[6-tert-butyl-8-(2,4-dioxo-1-pyridinyl)-5-methoxyquinolin-3-yl]pyrrolidin-3-yl]methyl]methanesulfonamide (PubChem CID 58536716) has the molecular formula C25H32N4O5S and a molecular weight of 500.62 g/mol. Its IUPAC name is N-[[(3S)-1-[6-tert-butyl-8-(2,4-dioxo-1-pyridinyl)-5-methoxyquinolin-3-yl]pyrrolidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[(3S)-1-[6-tert-butyl-8-(2,4-dioxo-1-pyridinyl)-5-methoxyquinolin-3-yl]pyrrolidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 58536716 |
| Molecular Formula | C25H32N4O5S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | N-[[(3S)-1-[6-tert-butyl-8-(2,4-dioxo-1-pyridinyl)-5-methoxyquinolin-3-yl]pyrrolidin-3-yl]methyl]methanesulfonamide |
| SMILES | COc1c(C(C)(C)C)cc(N2C=CC(=O)CC2=O)c2ncc(N3CC[C@H](CNS(C)(=O)=O)C3)cc12 |
| InChI | InChI=1S/C25H32N4O5S/c1-25(2,3)20-12-21(29-9-7-18(30)11-22(29)31)23-19(24(20)34-4)10-17(14-26-23)28-8-6-16(15-28)13-27-35(5,32)33/h7,9-10,12,14,16,27H,6,8,11,13,15H2,1-5H3/t16-/m1/s1 |
| InChIKey | KYLSCZQMPOKNOT-MRXNPFEDSA-N |
| XLogP | 2.74 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|