C24H30N4O6S — CID 67066379
N-[[5-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]-2-methoxyphenyl]methylideneamino]methanesulfonamide (PubChem CID 67066379) has the molecular formula C24H30N4O6S and a molecular weight of 502.59 g/mol. Its IUPAC name is N-[[5-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]-2-methoxyphenyl]methylideneamino]methanesulfonamide.
| Compound Name | N-[[5-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]-2-methoxyphenyl]methylideneamino]methanesulfonamide |
|---|---|
| PubChem CID | 67066379 |
| Molecular Formula | C24H30N4O6S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | N-[[5-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]-2-methoxyphenyl]methylideneamino]methanesulfonamide |
| SMILES | COc1ccc(-c2cc(N3CCC(=O)NC3=O)cc(C(C)(C)C)c2OC)cc1C=NNS(C)(=O)=O |
| InChI | InChI=1S/C24H30N4O6S/c1-24(2,3)19-13-17(28-10-9-21(29)26-23(28)30)12-18(22(19)34-5)15-7-8-20(33-4)16(11-15)14-25-27-35(6,31)32/h7-8,11-14,27H,9-10H2,1-6H3,(H,26,29,30) |
| InChIKey | JOIFILCBYLBHCA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|