C23H28N4O5S — CID 67066583
N-[[3-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]phenyl]methylideneamino]methanesulfonamide (PubChem CID 67066583) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-[[3-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]phenyl]methylideneamino]methanesulfonamide.
| Compound Name | N-[[3-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]phenyl]methylideneamino]methanesulfonamide |
|---|---|
| PubChem CID | 67066583 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-[[3-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]phenyl]methylideneamino]methanesulfonamide |
| SMILES | COc1c(-c2cccc(C=NNS(C)(=O)=O)c2)cc(N2CCC(=O)NC2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C23H28N4O5S/c1-23(2,3)19-13-17(27-10-9-20(28)25-22(27)29)12-18(21(19)32-4)16-8-6-7-15(11-16)14-24-26-33(5,30)31/h6-8,11-14,26H,9-10H2,1-5H3,(H,25,28,29) |
| InChIKey | CPIZZHKKVUIANU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|