C23H26F2N4O5S — CID 67066534
N-[[4-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]-2,6-difluorophenyl]methylideneamino]methanesulfonamide (PubChem CID 67066534) has the molecular formula C23H26F2N4O5S and a molecular weight of 508.55 g/mol. Its IUPAC name is N-[[4-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]-2,6-difluorophenyl]methylideneamino]methanesulfonamide.
| Compound Name | N-[[4-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]-2,6-difluorophenyl]methylideneamino]methanesulfonamide |
|---|---|
| PubChem CID | 67066534 |
| Molecular Formula | C23H26F2N4O5S |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | N-[[4-[3-tert-butyl-5-(2,4-dioxo-1,3-diazinan-1-yl)-2-methoxyphenyl]-2,6-difluorophenyl]methylideneamino]methanesulfonamide |
| SMILES | COc1c(-c2cc(F)c(C=NNS(C)(=O)=O)c(F)c2)cc(N2CCC(=O)NC2=O)cc1C(C)(C)C |
| InChI | InChI=1S/C23H26F2N4O5S/c1-23(2,3)17-11-14(29-7-6-20(30)27-22(29)31)10-15(21(17)34-4)13-8-18(24)16(19(25)9-13)12-26-28-35(5,32)33/h8-12,28H,6-7H2,1-5H3,(H,27,30,31) |
| InChIKey | BVXIEDGTRFZWHA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|