C9H20F2N2 — CID 58199556
N-ethyl-N',N'-difluoro-N-(2-methylpropyl)propane-1,3-diamine (PubChem CID 58199556) has the molecular formula C9H20F2N2 and a molecular weight of 194.27 g/mol. Its IUPAC name is N-ethyl-N',N'-difluoro-N-(2-methylpropyl)propane-1,3-diamine.
| Compound Name | N-ethyl-N',N'-difluoro-N-(2-methylpropyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 58199556 |
| Molecular Formula | C9H20F2N2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.16 |
| IUPAC Name | N-ethyl-N',N'-difluoro-N-(2-methylpropyl)propane-1,3-diamine |
| SMILES | CCN(CCCN(F)F)CC(C)C |
| InChI | InChI=1S/C9H20F2N2/c1-4-12(8-9(2)3)6-5-7-13(10)11/h9H,4-8H2,1-3H3 |
| InChIKey | SYSCMQLBDZQSND-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|