C19H20F3N3O — CID 58200577
5-[1-ethyl-3-(trifluoromethyl)pyrazol-5-yl]-2-(oxan-4-yl)-1H-indole (PubChem CID 58200577) has the molecular formula C19H20F3N3O and a molecular weight of 363.38 g/mol. Its IUPAC name is 5-[1-ethyl-3-(trifluoromethyl)pyrazol-5-yl]-2-(oxan-4-yl)-1H-indole.
| Compound Name | 5-[1-ethyl-3-(trifluoromethyl)pyrazol-5-yl]-2-(oxan-4-yl)-1H-indole |
|---|---|
| PubChem CID | 58200577 |
| Molecular Formula | C19H20F3N3O |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 5-[1-ethyl-3-(trifluoromethyl)pyrazol-5-yl]-2-(oxan-4-yl)-1H-indole |
| SMILES | CCn1nc(C(F)(F)F)cc1-c1ccc2[nH]c(C3CCOCC3)cc2c1 |
| InChI | InChI=1S/C19H20F3N3O/c1-2-25-17(11-18(24-25)19(20,21)22)13-3-4-15-14(9-13)10-16(23-15)12-5-7-26-8-6-12/h3-4,9-12,23H,2,5-8H2,1H3 |
| InChIKey | CFAFDQSQAFFRKW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |