C23H17ClN2O — CID 58200706
4-[2-(2-chloro-4-methoxyphenyl)-1H-indol-5-yl]-3-methylbenzonitrile (PubChem CID 58200706) has the molecular formula C23H17ClN2O and a molecular weight of 372.86 g/mol. Its IUPAC name is 4-[2-(2-chloro-4-methoxyphenyl)-1H-indol-5-yl]-3-methylbenzonitrile.
| Compound Name | 4-[2-(2-chloro-4-methoxyphenyl)-1H-indol-5-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 58200706 |
| Molecular Formula | C23H17ClN2O |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 4-[2-(2-chloro-4-methoxyphenyl)-1H-indol-5-yl]-3-methylbenzonitrile |
| SMILES | COc1ccc(-c2cc3cc(-c4ccc(C#N)cc4C)ccc3[nH]2)c(Cl)c1 |
| InChI | InChI=1S/C23H17ClN2O/c1-14-9-15(13-25)3-6-19(14)16-4-8-22-17(10-16)11-23(26-22)20-7-5-18(27-2)12-21(20)24/h3-12,26H,1-2H3 |
| InChIKey | VVMBBMCJGCOHIC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |