C27H25F2N3O — CID 123284616
4-[2-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-1H-indol-5-yl]-3-methylbenzonitrile (PubChem CID 123284616) has the molecular formula C27H25F2N3O and a molecular weight of 445.51 g/mol. Its IUPAC name is 4-[2-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-1H-indol-5-yl]-3-methylbenzonitrile.
| Compound Name | 4-[2-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-1H-indol-5-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 123284616 |
| Molecular Formula | C27H25F2N3O |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 4-[2-[4-[3-(dimethylamino)propoxy]-2,6-difluorophenyl]-1H-indol-5-yl]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1-c1ccc2[nH]c(-c3c(F)cc(OCCCN(C)C)cc3F)cc2c1 |
| InChI | InChI=1S/C27H25F2N3O/c1-17-11-18(16-30)5-7-22(17)19-6-8-25-20(12-19)13-26(31-25)27-23(28)14-21(15-24(27)29)33-10-4-9-32(2)3/h5-8,11-15,31H,4,9-10H2,1-3H3 |
| InChIKey | VTCBZAQMPDOPQF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|