C8H15N3 — CID 58204298
1-ethyl-3-methyl-5-propan-2-yl-1,2,4-triazole (PubChem CID 58204298) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 1-ethyl-3-methyl-5-propan-2-yl-1,2,4-triazole.
| Compound Name | 1-ethyl-3-methyl-5-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 58204298 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 1-ethyl-3-methyl-5-propan-2-yl-1,2,4-triazole |
| SMILES | CCn1nc(C)nc1C(C)C |
| InChI | InChI=1S/C8H15N3/c1-5-11-8(6(2)3)9-7(4)10-11/h6H,5H2,1-4H3 |
| InChIKey | IQFOOEOEDMWSQY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |