C11H22NO5S+ — CID 58206121
[(E,3S)-1-methoxy-5-[(2-methylpropan-2-yl)oxy]-1-methylsulfonyl-5-oxopent-1-en-3-yl]azanium (PubChem CID 58206121) has the molecular formula C11H22NO5S+ and a molecular weight of 280.37 g/mol. Its IUPAC name is [(E,3S)-1-methoxy-5-[(2-methylpropan-2-yl)oxy]-1-methylsulfonyl-5-oxopent-1-en-3-yl]azanium.
| Compound Name | [(E,3S)-1-methoxy-5-[(2-methylpropan-2-yl)oxy]-1-methylsulfonyl-5-oxopent-1-en-3-yl]azanium |
|---|---|
| PubChem CID | 58206121 |
| Molecular Formula | C11H22NO5S+ |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [(E,3S)-1-methoxy-5-[(2-methylpropan-2-yl)oxy]-1-methylsulfonyl-5-oxopent-1-en-3-yl]azanium |
| SMILES | CO/C(=C\[C@@H]([NH3+])CC(=O)OC(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C11H21NO5S/c1-11(2,3)17-9(13)6-8(12)7-10(16-4)18(5,14)15/h7-8H,6,12H2,1-5H3/p+1/b10-7+/t8-/m0/s1 |
| InChIKey | GOOSPRHPUPWWHU-VKHJRQFRSA-O |
| XLogP | -0.14 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|