C13H17NO3S — CID 58209111
6-tert-butyl-2-(methylsulfonylmethyl)-1,3-benzoxazole (PubChem CID 58209111) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 6-tert-butyl-2-(methylsulfonylmethyl)-1,3-benzoxazole.
| Compound Name | 6-tert-butyl-2-(methylsulfonylmethyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 58209111 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 6-tert-butyl-2-(methylsulfonylmethyl)-1,3-benzoxazole |
| SMILES | CC(C)(C)c1ccc2nc(CS(C)(=O)=O)oc2c1 |
| InChI | InChI=1S/C13H17NO3S/c1-13(2,3)9-5-6-10-11(7-9)17-12(14-10)8-18(4,15)16/h5-7H,8H2,1-4H3 |
| InChIKey | PLIKBVJVPXXWAI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |