C12H12FNO3 — CID 83870285
3-(6-fluoro-1,3-benzoxazol-2-yl)-2,2-dimethylpropanoic acid (PubChem CID 83870285) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is 3-(6-fluoro-1,3-benzoxazol-2-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(6-fluoro-1,3-benzoxazol-2-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 83870285 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 3-(6-fluoro-1,3-benzoxazol-2-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1nc2ccc(F)cc2o1)C(=O)O |
| InChI | InChI=1S/C12H12FNO3/c1-12(2,11(15)16)6-10-14-8-4-3-7(13)5-9(8)17-10/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | RTRPGJSKNWYTGI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |