C10H8FNO4 — CID 63675428
2-[(6-fluoro-1,3-benzoxazol-2-yl)methoxy]acetic acid (PubChem CID 63675428) has the molecular formula C10H8FNO4 and a molecular weight of 225.17 g/mol. Its IUPAC name is 2-[(6-fluoro-1,3-benzoxazol-2-yl)methoxy]acetic acid.
| Compound Name | 2-[(6-fluoro-1,3-benzoxazol-2-yl)methoxy]acetic acid |
|---|---|
| PubChem CID | 63675428 |
| Molecular Formula | C10H8FNO4 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-[(6-fluoro-1,3-benzoxazol-2-yl)methoxy]acetic acid |
| SMILES | O=C(O)COCc1nc2ccc(F)cc2o1 |
| InChI | InChI=1S/C10H8FNO4/c11-6-1-2-7-8(3-6)16-9(12-7)4-15-5-10(13)14/h1-3H,4-5H2,(H,13,14) |
| InChIKey | ZNSVOURGWAHREK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |