About 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid
2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid (PubChem CID 131073240) has the molecular formula C9H7NO3S
and a molecular weight of 209.23 g/mol. Its IUPAC name is 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid |
| PubChem CID | 131073240 |
| Molecular Formula | C9H7NO3S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid |
| SMILES | O=C(O)Cc1nc2ccc(S)cc2o1 |
| InChI | InChI=1S/C9H7NO3S/c11-9(12)4-8-10-6-2-1-5(14)3-7(6)13-8/h1-3,14H,4H2,(H,11,12) |
| InChIKey | XHGALESXPVZOFH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid?
The IUPAC name of 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid (CID 131073240) is 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid.
What is the SMILES notation for 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid?
The canonical SMILES for 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid is O=C(O)Cc1nc2ccc(S)cc2o1.
What is the InChIKey of 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid?
The InChIKey is XHGALESXPVZOFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO3S/c11-9(12)4-8-10-6-2-1-5(14)3-7(6)13-8/h1-3,14H,4H2,(H,11,12).
What are the key properties of 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid?
2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid has a molecular weight of 209.23 g/mol, XLogP of 1.74, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-sulfanyl-1,3-benzoxazol-2-yl)acetic acid is sourced from PubChem (CID 131073240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).