C9H9NO2S — CID 131090717
2-ethoxy-1,3-benzoxazole-6-thiol (PubChem CID 131090717) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-ethoxy-1,3-benzoxazole-6-thiol.
| Compound Name | 2-ethoxy-1,3-benzoxazole-6-thiol |
|---|---|
| PubChem CID | 131090717 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2-ethoxy-1,3-benzoxazole-6-thiol |
| SMILES | CCOc1nc2ccc(S)cc2o1 |
| InChI | InChI=1S/C9H9NO2S/c1-2-11-9-10-7-4-3-6(13)5-8(7)12-9/h3-5,13H,2H2,1H3 |
| InChIKey | MABNZIVLXUBNDV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|