C21H23ClN2O — CID 58210862
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[6-(2-chlorophenyl)-2-pyridinyl]methanone (PubChem CID 58210862) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[6-(2-chlorophenyl)-2-pyridinyl]methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[6-(2-chlorophenyl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 58210862 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[6-(2-chlorophenyl)-2-pyridinyl]methanone |
| SMILES | O=C(c1cccc(-c2ccccc2Cl)n1)N1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C21H23ClN2O/c22-18-9-4-3-8-17(18)19-10-5-11-20(23-19)21(25)24-13-12-15-6-1-2-7-16(15)14-24/h3-5,8-11,15-16H,1-2,6-7,12-14H2/t15-,16+/m0/s1 |
| InChIKey | ZMLSQMCTGMTYJM-JKSUJKDBSA-N |
| XLogP | 5.05 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |