C22H24Cl2N2OS — CID 58210563
[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[5-[(2,6-dichlorophenyl)sulfanylmethyl]-3-pyridinyl]methanone (PubChem CID 58210563) has the molecular formula C22H24Cl2N2OS and a molecular weight of 435.42 g/mol. Its IUPAC name is [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[5-[(2,6-dichlorophenyl)sulfanylmethyl]-3-pyridinyl]methanone.
| Compound Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[5-[(2,6-dichlorophenyl)sulfanylmethyl]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 58210563 |
| Molecular Formula | C22H24Cl2N2OS |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | [(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-[5-[(2,6-dichlorophenyl)sulfanylmethyl]-3-pyridinyl]methanone |
| SMILES | O=C(c1cncc(CSc2c(Cl)cccc2Cl)c1)N1CC[C@@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C22H24Cl2N2OS/c23-19-6-3-7-20(24)21(19)28-14-15-10-18(12-25-11-15)22(27)26-9-8-16-4-1-2-5-17(16)13-26/h3,6-7,10-12,16-17H,1-2,4-5,8-9,13-14H2/t16-,17+/m0/s1 |
| InChIKey | PNBMJCWOGLXYHH-DLBZAZTESA-N |
| XLogP | 6.33 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |