C19H19Cl3N2OS — CID 58210974
(4-methylpiperidin-1-yl)-[5-[(2,4,5-trichlorophenyl)sulfanylmethyl]-3-pyridinyl]methanone (PubChem CID 58210974) has the molecular formula C19H19Cl3N2OS and a molecular weight of 429.80 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[5-[(2,4,5-trichlorophenyl)sulfanylmethyl]-3-pyridinyl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[5-[(2,4,5-trichlorophenyl)sulfanylmethyl]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 58210974 |
| Molecular Formula | C19H19Cl3N2OS |
| Molecular Weight | 429.80 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[5-[(2,4,5-trichlorophenyl)sulfanylmethyl]-3-pyridinyl]methanone |
| SMILES | CC1CCN(C(=O)c2cncc(CSc3cc(Cl)c(Cl)cc3Cl)c2)CC1 |
| InChI | InChI=1S/C19H19Cl3N2OS/c1-12-2-4-24(5-3-12)19(25)14-6-13(9-23-10-14)11-26-18-8-16(21)15(20)7-17(18)22/h6-10,12H,2-5,11H2,1H3 |
| InChIKey | RBJXBMDXORKQJI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.80 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|