C18H22ClN3OS — CID 58214375
N'-[4-[[4-(1-chlorocyclopropyl)-1,3-thiazol-2-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 58214375) has the molecular formula C18H22ClN3OS and a molecular weight of 363.91 g/mol. Its IUPAC name is N'-[4-[[4-(1-chlorocyclopropyl)-1,3-thiazol-2-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[[4-(1-chlorocyclopropyl)-1,3-thiazol-2-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 58214375 |
| Molecular Formula | C18H22ClN3OS |
| Molecular Weight | 363.91 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N'-[4-[[4-(1-chlorocyclopropyl)-1,3-thiazol-2-yl]oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2nc(C3(Cl)CC3)cs2)cc1C |
| InChI | InChI=1S/C18H22ClN3OS/c1-5-22(4)11-20-14-8-13(3)15(9-12(14)2)23-17-21-16(10-24-17)18(19)6-7-18/h8-11H,5-7H2,1-4H3/b20-11+ |
| InChIKey | MCIGYMKGPIVLNA-RGVLZGJSSA-N |
| XLogP | 5.39 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|