C19H26BrN3OS — CID 58214472
N'-[4-[(4-bromo-5-tert-butyl-1,3-thiazol-2-yl)oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 58214472) has the molecular formula C19H26BrN3OS and a molecular weight of 424.41 g/mol. Its IUPAC name is N'-[4-[(4-bromo-5-tert-butyl-1,3-thiazol-2-yl)oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[(4-bromo-5-tert-butyl-1,3-thiazol-2-yl)oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 58214472 |
| Molecular Formula | C19H26BrN3OS |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | N'-[4-[(4-bromo-5-tert-butyl-1,3-thiazol-2-yl)oxy]-2,5-dimethylphenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2nc(Br)c(C(C)(C)C)s2)cc1C |
| InChI | InChI=1S/C19H26BrN3OS/c1-8-23(7)11-21-14-9-13(3)15(10-12(14)2)24-18-22-17(20)16(25-18)19(4,5)6/h9-11H,8H2,1-7H3/b21-11+ |
| InChIKey | LFDMBRIFEVFRST-SRZZPIQSSA-N |
| XLogP | 6.22 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|