C21H20ClN5O2 — CID 58215629
N-[[5-(6-chloro-3-cyano-1-methylindol-2-yl)-3-pyridinyl]methyl]morpholine-4-carboxamide (PubChem CID 58215629) has the molecular formula C21H20ClN5O2 and a molecular weight of 409.88 g/mol. Its IUPAC name is N-[[5-(6-chloro-3-cyano-1-methylindol-2-yl)-3-pyridinyl]methyl]morpholine-4-carboxamide.
| Compound Name | N-[[5-(6-chloro-3-cyano-1-methylindol-2-yl)-3-pyridinyl]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 58215629 |
| Molecular Formula | C21H20ClN5O2 |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[[5-(6-chloro-3-cyano-1-methylindol-2-yl)-3-pyridinyl]methyl]morpholine-4-carboxamide |
| SMILES | Cn1c(-c2cncc(CNC(=O)N3CCOCC3)c2)c(C#N)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H20ClN5O2/c1-26-19-9-16(22)2-3-17(19)18(10-23)20(26)15-8-14(11-24-13-15)12-25-21(28)27-4-6-29-7-5-27/h2-3,8-9,11,13H,4-7,12H2,1H3,(H,25,28) |
| InChIKey | DPAGDPGPEVXSQX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |