C23H30N6O — CID 58217104
3-(diethylamino)-N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]prop-2-enamide (PubChem CID 58217104) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 3-(diethylamino)-N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]prop-2-enamide.
| Compound Name | 3-(diethylamino)-N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 58217104 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 3-(diethylamino)-N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]prop-2-enamide |
| SMILES | CCN(C=CC(=O)Nc1ccc2ncn(-c3cncc(CC(C)(C)C)n3)c2c1)CC |
| InChI | InChI=1S/C23H30N6O/c1-6-28(7-2)11-10-22(30)27-17-8-9-19-20(12-17)29(16-25-19)21-15-24-14-18(26-21)13-23(3,4)5/h8-12,14-16H,6-7,13H2,1-5H3,(H,27,30) |
| InChIKey | SYEXBLNAWIWCQM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|