C16H17N5 — CID 58217151
3-[6-(2-cyclopropylethyl)pyrazin-2-yl]benzimidazol-5-amine (PubChem CID 58217151) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 3-[6-(2-cyclopropylethyl)pyrazin-2-yl]benzimidazol-5-amine.
| Compound Name | 3-[6-(2-cyclopropylethyl)pyrazin-2-yl]benzimidazol-5-amine |
|---|---|
| PubChem CID | 58217151 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 3-[6-(2-cyclopropylethyl)pyrazin-2-yl]benzimidazol-5-amine |
| SMILES | Nc1ccc2ncn(-c3cncc(CCC4CC4)n3)c2c1 |
| InChI | InChI=1S/C16H17N5/c17-12-4-6-14-15(7-12)21(10-19-14)16-9-18-8-13(20-16)5-3-11-1-2-11/h4,6-11H,1-3,5,17H2 |
| InChIKey | RGOZBQXDIDFEQO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|