About N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide
N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide (PubChem CID 58217156) has the molecular formula C18H21N5O2S
and a molecular weight of 371.47 g/mol. Its IUPAC name is N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide.
Molecular Properties
| Compound Name | N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide |
| PubChem CID | 58217156 |
| Molecular Formula | C18H21N5O2S |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide |
| SMILES | C=CS(=O)(=O)Nc1ccc2ncn(-c3cncc(CC(C)(C)C)n3)c2c1 |
| InChI | InChI=1S/C18H21N5O2S/c1-5-26(24,25)22-13-6-7-15-16(8-13)23(12-20-15)17-11-19-10-14(21-17)9-18(2,3)4/h5-8,10-12,22H,1,9H2,2-4H3 |
| InChIKey | JKUDGPZODGDHNC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide?
The IUPAC name of N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide (CID 58217156) is N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide.
What is the SMILES notation for N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide?
The canonical SMILES for N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide is C=CS(=O)(=O)Nc1ccc2ncn(-c3cncc(CC(C)(C)C)n3)c2c1.
What is the InChIKey of N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide?
The InChIKey is JKUDGPZODGDHNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N5O2S/c1-5-26(24,25)22-13-6-7-15-16(8-13)23(12-20-15)17-11-19-10-14(21-17)9-18(2,3)4/h5-8,10-12,22H,1,9H2,2-4H3.
What are the key properties of N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide?
N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide has a molecular weight of 371.47 g/mol, XLogP of 3.29, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[6-(2,2-dimethylpropyl)pyrazin-2-yl]benzimidazol-5-yl]ethenesulfonamide is sourced from PubChem (CID 58217156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).