C24H22F6N2O2 — CID 58218864
N-[3,5-bis(trifluoromethyl)phenyl]-2-(2,6-dimethylphenyl)-3-oxo-3a,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-6a-carboxamide (PubChem CID 58218864) has the molecular formula C24H22F6N2O2 and a molecular weight of 484.44 g/mol. Its IUPAC name is N-[3,5-bis(trifluoromethyl)phenyl]-2-(2,6-dimethylphenyl)-3-oxo-3a,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-6a-carboxamide.
| Compound Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(2,6-dimethylphenyl)-3-oxo-3a,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-6a-carboxamide |
|---|---|
| PubChem CID | 58218864 |
| Molecular Formula | C24H22F6N2O2 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-2-(2,6-dimethylphenyl)-3-oxo-3a,4,5,6-tetrahydro-1H-cyclopenta[c]pyrrole-6a-carboxamide |
| SMILES | Cc1cccc(C)c1N1CC2(C(=O)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CCCC2C1=O |
| InChI | InChI=1S/C24H22F6N2O2/c1-13-5-3-6-14(2)19(13)32-12-22(8-4-7-18(22)20(32)33)21(34)31-17-10-15(23(25,26)27)9-16(11-17)24(28,29)30/h3,5-6,9-11,18H,4,7-8,12H2,1-2H3,(H,31,34) |
| InChIKey | OAMQNZXGLBMYJT-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |