C25H33NO6 — CID 58219016
5-methyl-4-oxo-N-[2-[2-[(Z)-4-oxonon-6-enoxy]ethoxy]ethyl]-5-phenylfuran-2-carboxamide (PubChem CID 58219016) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is 5-methyl-4-oxo-N-[2-[2-[(Z)-4-oxonon-6-enoxy]ethoxy]ethyl]-5-phenylfuran-2-carboxamide.
| Compound Name | 5-methyl-4-oxo-N-[2-[2-[(Z)-4-oxonon-6-enoxy]ethoxy]ethyl]-5-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 58219016 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 5-methyl-4-oxo-N-[2-[2-[(Z)-4-oxonon-6-enoxy]ethoxy]ethyl]-5-phenylfuran-2-carboxamide |
| SMILES | CC/C=C\CC(=O)CCCOCCOCCNC(=O)C1=CC(=O)C(C)(c2ccccc2)O1 |
| InChI | InChI=1S/C25H33NO6/c1-3-4-6-12-21(27)13-9-15-30-17-18-31-16-14-26-24(29)22-19-23(28)25(2,32-22)20-10-7-5-8-11-20/h4-8,10-11,19H,3,9,12-18H2,1-2H3,(H,26,29)/b6-4- |
| InChIKey | ZYLIKTPEOYNRKU-XQRVVYSFSA-N |
| XLogP | 3.24 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|